C20H20FN3O2S2 — CID 3753390
2-[(3-amino-12-propyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl)sulfanyl]-1-(4-fluorophenyl)ethanone (PubChem CID 3753390) has the molecular formula C20H20FN3O2S2 and a molecular weight of 417.53 g/mol. Its IUPAC name is 2-[(3-amino-12-propyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl)sulfanyl]-1-(4-fluorophenyl)ethanone.
| Compound Name | 2-[(3-amino-12-propyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl)sulfanyl]-1-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 3753390 |
| Molecular Formula | C20H20FN3O2S2 |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 2-[(3-amino-12-propyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl)sulfanyl]-1-(4-fluorophenyl)ethanone |
| SMILES | CCCC1Cc2c(sc3nc(SCC(=O)c4ccc(F)cc4)nc(N)c23)CO1 |
| InChI | InChI=1S/C20H20FN3O2S2/c1-2-3-13-8-14-16(9-26-13)28-19-17(14)18(22)23-20(24-19)27-10-15(25)11-4-6-12(21)7-5-11/h4-7,13H,2-3,8-10H2,1H3,(H2,22,23,24) |
| InChIKey | LKWJCIJKLVVFOP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |