About 1-(furan-2-yl)-N,N-dimethylethane-1,2-diamine
1-(furan-2-yl)-N,N-dimethylethane-1,2-diamine (PubChem CID 3754087) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is 1-(furan-2-yl)-N,N-dimethylethane-1,2-diamine.
Molecular Properties
| Compound Name | 1-(furan-2-yl)-N,N-dimethylethane-1,2-diamine |
| PubChem CID | 3754087 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 1-(furan-2-yl)-N,N-dimethylethane-1,2-diamine |
| SMILES | CN(C)C(CN)c1ccco1 |
| InChI | InChI=1S/C8H14N2O/c1-10(2)7(6-9)8-4-3-5-11-8/h3-5,7H,6,9H2,1-2H3 |
| InChIKey | AZJFCUDCKGDHOQ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(furan-2-yl)-N,N-dimethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(furan-2-yl)-N,N-dimethylethane-1,2-diamine?
The IUPAC name of 1-(furan-2-yl)-N,N-dimethylethane-1,2-diamine (CID 3754087) is 1-(furan-2-yl)-N,N-dimethylethane-1,2-diamine.
What is the SMILES notation for 1-(furan-2-yl)-N,N-dimethylethane-1,2-diamine?
The canonical SMILES for 1-(furan-2-yl)-N,N-dimethylethane-1,2-diamine is CN(C)C(CN)c1ccco1.
What is the InChIKey of 1-(furan-2-yl)-N,N-dimethylethane-1,2-diamine?
The InChIKey is AZJFCUDCKGDHOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O/c1-10(2)7(6-9)8-4-3-5-11-8/h3-5,7H,6,9H2,1-2H3.
What are the key properties of 1-(furan-2-yl)-N,N-dimethylethane-1,2-diamine?
1-(furan-2-yl)-N,N-dimethylethane-1,2-diamine has a molecular weight of 154.21 g/mol, XLogP of 0.84, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(furan-2-yl)-N,N-dimethylethane-1,2-diamine is sourced from PubChem (CID 3754087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).