C17H21NO3S — CID 3754148
N-(1-methoxybutan-2-yl)-4-phenylbenzenesulfonamide (PubChem CID 3754148) has the molecular formula C17H21NO3S and a molecular weight of 319.43 g/mol. Its IUPAC name is N-(1-methoxybutan-2-yl)-4-phenylbenzenesulfonamide.
| Compound Name | N-(1-methoxybutan-2-yl)-4-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 3754148 |
| Molecular Formula | C17H21NO3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | N-(1-methoxybutan-2-yl)-4-phenylbenzenesulfonamide |
| SMILES | CCC(COC)NS(=O)(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C17H21NO3S/c1-3-16(13-21-2)18-22(19,20)17-11-9-15(10-12-17)14-7-5-4-6-8-14/h4-12,16,18H,3,13H2,1-2H3 |
| InChIKey | NGFNBHFQPWKIGV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |