C19H14Cl3NO2 — CID 3754731
1,2,3-trichloro-4-piperidin-1-ylanthracene-9,10-dione (PubChem CID 3754731) has the molecular formula C19H14Cl3NO2 and a molecular weight of 394.69 g/mol. Its IUPAC name is 1,2,3-trichloro-4-piperidin-1-ylanthracene-9,10-dione.
| Compound Name | 1,2,3-trichloro-4-piperidin-1-ylanthracene-9,10-dione |
|---|---|
| PubChem CID | 3754731 |
| Molecular Formula | C19H14Cl3NO2 |
| Molecular Weight | 394.69 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | 1,2,3-trichloro-4-piperidin-1-ylanthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1c(Cl)c(Cl)c(Cl)c2N1CCCCC1 |
| InChI | InChI=1S/C19H14Cl3NO2/c20-14-12-13(19(25)11-7-3-2-6-10(11)18(12)24)17(16(22)15(14)21)23-8-4-1-5-9-23/h2-3,6-7H,1,4-5,8-9H2 |
| InChIKey | IXECHRJYKUKIQA-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.69 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|