C15H22N6 — CID 3755036
7-methyl-3-(2-piperidin-1-ylethyl)-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene (PubChem CID 3755036) has the molecular formula C15H22N6 and a molecular weight of 286.38 g/mol. Its IUPAC name is 7-methyl-3-(2-piperidin-1-ylethyl)-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene.
| Compound Name | 7-methyl-3-(2-piperidin-1-ylethyl)-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene |
|---|---|
| PubChem CID | 3755036 |
| Molecular Formula | C15H22N6 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 7-methyl-3-(2-piperidin-1-ylethyl)-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene |
| SMILES | Cc1nc2ncnn2c2c1CCN2CCN1CCCCC1 |
| InChI | InChI=1S/C15H22N6/c1-12-13-5-8-20(10-9-19-6-3-2-4-7-19)14(13)21-15(18-12)16-11-17-21/h11H,2-10H2,1H3 |
| InChIKey | CSYHUNBSXVWNQW-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 49.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |