C7H11NO4S — CID 3755130
5,5-dimethyl-1,3-thiazolidine-2,4-dicarboxylic acid (PubChem CID 3755130) has the molecular formula C7H11NO4S and a molecular weight of 205.23 g/mol. Its IUPAC name is 5,5-dimethyl-1,3-thiazolidine-2,4-dicarboxylic acid.
| Compound Name | 5,5-dimethyl-1,3-thiazolidine-2,4-dicarboxylic acid |
|---|---|
| PubChem CID | 3755130 |
| Molecular Formula | C7H11NO4S |
| Molecular Weight | 205.23 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 5,5-dimethyl-1,3-thiazolidine-2,4-dicarboxylic acid |
| SMILES | CC1(C)SC(C(=O)O)NC1C(=O)O |
| InChI | InChI=1S/C7H11NO4S/c1-7(2)3(5(9)10)8-4(13-7)6(11)12/h3-4,8H,1-2H3,(H,9,10)(H,11,12) |
| InChIKey | HTHNEPWLOCHROG-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.23 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |