C13H8FN5O3 — CID 3755425
5-[2-(4-fluorophenyl)ethenyl]-6-nitro-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 3755425) has the molecular formula C13H8FN5O3 and a molecular weight of 301.24 g/mol. Its IUPAC name is 5-[2-(4-fluorophenyl)ethenyl]-6-nitro-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 5-[2-(4-fluorophenyl)ethenyl]-6-nitro-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 3755425 |
| Molecular Formula | C13H8FN5O3 |
| Molecular Weight | 301.24 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 5-[2-(4-fluorophenyl)ethenyl]-6-nitro-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | O=c1c([N+](=O)[O-])c(C=Cc2ccc(F)cc2)nc2nc[nH]n12 |
| InChI | InChI=1S/C13H8FN5O3/c14-9-4-1-8(2-5-9)3-6-10-11(19(21)22)12(20)18-13(17-10)15-7-16-18/h1-7H,(H,15,16,17) |
| InChIKey | XCBNTLMMKOQGAQ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|