C14H15Cl2NO — CID 3756373
1,1-dichloro-2,2,7b-trimethyl-1aH-cyclopropa[c]quinoline-3-carbaldehyde (PubChem CID 3756373) has the molecular formula C14H15Cl2NO and a molecular weight of 284.19 g/mol. Its IUPAC name is 1,1-dichloro-2,2,7b-trimethyl-1aH-cyclopropa[c]quinoline-3-carbaldehyde.
| Compound Name | 1,1-dichloro-2,2,7b-trimethyl-1aH-cyclopropa[c]quinoline-3-carbaldehyde |
|---|---|
| PubChem CID | 3756373 |
| Molecular Formula | C14H15Cl2NO |
| Molecular Weight | 284.19 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 1,1-dichloro-2,2,7b-trimethyl-1aH-cyclopropa[c]quinoline-3-carbaldehyde |
| SMILES | CC1(C)C2C(Cl)(Cl)C2(C)c2ccccc2N1C=O |
| InChI | InChI=1S/C14H15Cl2NO/c1-12(2)11-13(3,14(11,15)16)9-6-4-5-7-10(9)17(12)8-18/h4-8,11H,1-3H3 |
| InChIKey | ZIIPOTCZHKXENU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.19 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|