C10H8F3NO3S — CID 3756806
methyl 3-[(4,4,4-trifluoro-3-oxobut-1-enyl)amino]thiophene-2-carboxylate (PubChem CID 3756806) has the molecular formula C10H8F3NO3S and a molecular weight of 279.24 g/mol. Its IUPAC name is methyl 3-[(4,4,4-trifluoro-3-oxobut-1-enyl)amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[(4,4,4-trifluoro-3-oxobut-1-enyl)amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 3756806 |
| Molecular Formula | C10H8F3NO3S |
| Molecular Weight | 279.24 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | methyl 3-[(4,4,4-trifluoro-3-oxobut-1-enyl)amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC=CC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H8F3NO3S/c1-17-9(16)8-6(3-5-18-8)14-4-2-7(15)10(11,12)13/h2-5,14H,1H3 |
| InChIKey | HDABUFKRZWXZQN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.24 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|