About methyl 3-[(4,4,4-trifluoro-3-oxobut-1-enyl)amino]thiophene-2-carboxylate
methyl 3-[(4,4,4-trifluoro-3-oxobut-1-enyl)amino]thiophene-2-carboxylate (PubChem CID 3756806) has the molecular formula C10H8F3NO3S
and a molecular weight of 279.24 g/mol. Its IUPAC name is methyl 3-[(4,4,4-trifluoro-3-oxobut-1-enyl)amino]thiophene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-[(4,4,4-trifluoro-3-oxobut-1-enyl)amino]thiophene-2-carboxylate |
| PubChem CID | 3756806 |
| Molecular Formula | C10H8F3NO3S |
| Molecular Weight | 279.24 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | methyl 3-[(4,4,4-trifluoro-3-oxobut-1-enyl)amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC=CC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H8F3NO3S/c1-17-9(16)8-6(3-5-18-8)14-4-2-7(15)10(11,12)13/h2-5,14H,1H3 |
| InChIKey | HDABUFKRZWXZQN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.24 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[(4,4,4-trifluoro-3-oxobut-1-enyl)amino]thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(4,4,4-trifluoro-3-oxobut-1-enyl)amino]thiophene-2-carboxylate?
The IUPAC name of methyl 3-[(4,4,4-trifluoro-3-oxobut-1-enyl)amino]thiophene-2-carboxylate (CID 3756806) is methyl 3-[(4,4,4-trifluoro-3-oxobut-1-enyl)amino]thiophene-2-carboxylate.
What is the SMILES notation for methyl 3-[(4,4,4-trifluoro-3-oxobut-1-enyl)amino]thiophene-2-carboxylate?
The canonical SMILES for methyl 3-[(4,4,4-trifluoro-3-oxobut-1-enyl)amino]thiophene-2-carboxylate is COC(=O)c1sccc1NC=CC(=O)C(F)(F)F.
What is the InChIKey of methyl 3-[(4,4,4-trifluoro-3-oxobut-1-enyl)amino]thiophene-2-carboxylate?
The InChIKey is HDABUFKRZWXZQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F3NO3S/c1-17-9(16)8-6(3-5-18-8)14-4-2-7(15)10(11,12)13/h2-5,14H,1H3.
What are the key properties of methyl 3-[(4,4,4-trifluoro-3-oxobut-1-enyl)amino]thiophene-2-carboxylate?
methyl 3-[(4,4,4-trifluoro-3-oxobut-1-enyl)amino]thiophene-2-carboxylate has a molecular weight of 279.24 g/mol, XLogP of 2.59, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(4,4,4-trifluoro-3-oxobut-1-enyl)amino]thiophene-2-carboxylate is sourced from PubChem (CID 3756806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).