C17H10Cl2N2O3 — CID 3756933
3-(2,4-dichlorophenyl)-5-phenyl-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 3756933) has the molecular formula C17H10Cl2N2O3 and a molecular weight of 361.18 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-5-phenyl-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | 3-(2,4-dichlorophenyl)-5-phenyl-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 3756933 |
| Molecular Formula | C17H10Cl2N2O3 |
| Molecular Weight | 361.18 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-5-phenyl-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | O=C1C2ON=C(c3ccc(Cl)cc3Cl)C2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C17H10Cl2N2O3/c18-9-6-7-11(12(19)8-9)14-13-15(24-20-14)17(23)21(16(13)22)10-4-2-1-3-5-10/h1-8,13,15H |
| InChIKey | KTKVFMQNMCGTRL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.18 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|