About 5-(2-fluorobenzoyl)-3,4-dihydro-1H-1,5-benzodiazepin-2-one
5-(2-fluorobenzoyl)-3,4-dihydro-1H-1,5-benzodiazepin-2-one (PubChem CID 3757029) has the molecular formula C16H13FN2O2
and a molecular weight of 284.29 g/mol. Its IUPAC name is 5-(2-fluorobenzoyl)-3,4-dihydro-1H-1,5-benzodiazepin-2-one.
Molecular Properties
| Compound Name | 5-(2-fluorobenzoyl)-3,4-dihydro-1H-1,5-benzodiazepin-2-one |
| PubChem CID | 3757029 |
| Molecular Formula | C16H13FN2O2 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 5-(2-fluorobenzoyl)-3,4-dihydro-1H-1,5-benzodiazepin-2-one |
| SMILES | O=C1CCN(C(=O)c2ccccc2F)c2ccccc2N1 |
| InChI | InChI=1S/C16H13FN2O2/c17-12-6-2-1-5-11(12)16(21)19-10-9-15(20)18-13-7-3-4-8-14(13)19/h1-8H,9-10H2,(H,18,20) |
| InChIKey | KHHPBSXNIDLOLP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2-fluorobenzoyl)-3,4-dihydro-1H-1,5-benzodiazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-fluorobenzoyl)-3,4-dihydro-1H-1,5-benzodiazepin-2-one?
The IUPAC name of 5-(2-fluorobenzoyl)-3,4-dihydro-1H-1,5-benzodiazepin-2-one (CID 3757029) is 5-(2-fluorobenzoyl)-3,4-dihydro-1H-1,5-benzodiazepin-2-one.
What is the SMILES notation for 5-(2-fluorobenzoyl)-3,4-dihydro-1H-1,5-benzodiazepin-2-one?
The canonical SMILES for 5-(2-fluorobenzoyl)-3,4-dihydro-1H-1,5-benzodiazepin-2-one is O=C1CCN(C(=O)c2ccccc2F)c2ccccc2N1.
What is the InChIKey of 5-(2-fluorobenzoyl)-3,4-dihydro-1H-1,5-benzodiazepin-2-one?
The InChIKey is KHHPBSXNIDLOLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13FN2O2/c17-12-6-2-1-5-11(12)16(21)19-10-9-15(20)18-13-7-3-4-8-14(13)19/h1-8H,9-10H2,(H,18,20).
What are the key properties of 5-(2-fluorobenzoyl)-3,4-dihydro-1H-1,5-benzodiazepin-2-one?
5-(2-fluorobenzoyl)-3,4-dihydro-1H-1,5-benzodiazepin-2-one has a molecular weight of 284.29 g/mol, XLogP of 2.81, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-fluorobenzoyl)-3,4-dihydro-1H-1,5-benzodiazepin-2-one is sourced from PubChem (CID 3757029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).