C14H17N3O2S — CID 3757637
3-methyl-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)butanoic acid (PubChem CID 3757637) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is 3-methyl-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)butanoic acid.
| Compound Name | 3-methyl-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)butanoic acid |
|---|---|
| PubChem CID | 3757637 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 3-methyl-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)butanoic acid |
| SMILES | CC(C)C(Nc1ncnc2sc3c(c12)CCC3)C(=O)O |
| InChI | InChI=1S/C14H17N3O2S/c1-7(2)11(14(18)19)17-12-10-8-4-3-5-9(8)20-13(10)16-6-15-12/h6-7,11H,3-5H2,1-2H3,(H,18,19)(H,15,16,17) |
| InChIKey | GWCDEYDMKMNWKP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |