About 4-(5-bromo-2,4-dimethoxyphenyl)-1,3-thiazol-2-amine
4-(5-bromo-2,4-dimethoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 3757650) has the molecular formula C11H11BrN2O2S
and a molecular weight of 315.19 g/mol. Its IUPAC name is 4-(5-bromo-2,4-dimethoxyphenyl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-(5-bromo-2,4-dimethoxyphenyl)-1,3-thiazol-2-amine |
| PubChem CID | 3757650 |
| Molecular Formula | C11H11BrN2O2S |
| Molecular Weight | 315.19 g/mol |
| Exact Mass | 313.97 |
| IUPAC Name | 4-(5-bromo-2,4-dimethoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | COc1cc(OC)c(-c2csc(N)n2)cc1Br |
| InChI | InChI=1S/C11H11BrN2O2S/c1-15-9-4-10(16-2)7(12)3-6(9)8-5-17-11(13)14-8/h3-5H,1-2H3,(H2,13,14) |
| InChIKey | SZIZGAJPZFWHBQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.19 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(5-bromo-2,4-dimethoxyphenyl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-bromo-2,4-dimethoxyphenyl)-1,3-thiazol-2-amine?
The IUPAC name of 4-(5-bromo-2,4-dimethoxyphenyl)-1,3-thiazol-2-amine (CID 3757650) is 4-(5-bromo-2,4-dimethoxyphenyl)-1,3-thiazol-2-amine.
What is the SMILES notation for 4-(5-bromo-2,4-dimethoxyphenyl)-1,3-thiazol-2-amine?
The canonical SMILES for 4-(5-bromo-2,4-dimethoxyphenyl)-1,3-thiazol-2-amine is COc1cc(OC)c(-c2csc(N)n2)cc1Br.
What is the InChIKey of 4-(5-bromo-2,4-dimethoxyphenyl)-1,3-thiazol-2-amine?
The InChIKey is SZIZGAJPZFWHBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrN2O2S/c1-15-9-4-10(16-2)7(12)3-6(9)8-5-17-11(13)14-8/h3-5H,1-2H3,(H2,13,14).
What are the key properties of 4-(5-bromo-2,4-dimethoxyphenyl)-1,3-thiazol-2-amine?
4-(5-bromo-2,4-dimethoxyphenyl)-1,3-thiazol-2-amine has a molecular weight of 315.19 g/mol, XLogP of 3.17, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-bromo-2,4-dimethoxyphenyl)-1,3-thiazol-2-amine is sourced from PubChem (CID 3757650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).