C21H17Cl2NO3 — CID 3757673
3-(3,5-dichlorophenyl)-2,4,7,8,9,10-hexahydroisochromeno[3,4-f][1,3]benzoxazin-6-one (PubChem CID 3757673) has the molecular formula C21H17Cl2NO3 and a molecular weight of 402.28 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-2,4,7,8,9,10-hexahydroisochromeno[3,4-f][1,3]benzoxazin-6-one.
| Compound Name | 3-(3,5-dichlorophenyl)-2,4,7,8,9,10-hexahydroisochromeno[3,4-f][1,3]benzoxazin-6-one |
|---|---|
| PubChem CID | 3757673 |
| Molecular Formula | C21H17Cl2NO3 |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-2,4,7,8,9,10-hexahydroisochromeno[3,4-f][1,3]benzoxazin-6-one |
| SMILES | O=c1oc2c3c(ccc2c2c1CCCC2)OCN(c1cc(Cl)cc(Cl)c1)C3 |
| InChI | InChI=1S/C21H17Cl2NO3/c22-12-7-13(23)9-14(8-12)24-10-18-19(26-11-24)6-5-16-15-3-1-2-4-17(15)21(25)27-20(16)18/h5-9H,1-4,10-11H2 |
| InChIKey | HKUWNGRVDVFDLM-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|