About 4-imidazo[1,2-a]pyrimidin-3-ylmorpholine
4-imidazo[1,2-a]pyrimidin-3-ylmorpholine (PubChem CID 3757823) has the molecular formula C10H12N4O
and a molecular weight of 204.23 g/mol. Its IUPAC name is 4-imidazo[1,2-a]pyrimidin-3-ylmorpholine.
Molecular Properties
| Compound Name | 4-imidazo[1,2-a]pyrimidin-3-ylmorpholine |
| PubChem CID | 3757823 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 4-imidazo[1,2-a]pyrimidin-3-ylmorpholine |
| SMILES | c1cnc2ncc(N3CCOCC3)n2c1 |
| InChI | InChI=1S/C10H12N4O/c1-2-11-10-12-8-9(14(10)3-1)13-4-6-15-7-5-13/h1-3,8H,4-7H2 |
| InChIKey | VRMFYNIJJLOGEE-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 42.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-imidazo[1,2-a]pyrimidin-3-ylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imidazo[1,2-a]pyrimidin-3-ylmorpholine?
The IUPAC name of 4-imidazo[1,2-a]pyrimidin-3-ylmorpholine (CID 3757823) is 4-imidazo[1,2-a]pyrimidin-3-ylmorpholine.
What is the SMILES notation for 4-imidazo[1,2-a]pyrimidin-3-ylmorpholine?
The canonical SMILES for 4-imidazo[1,2-a]pyrimidin-3-ylmorpholine is c1cnc2ncc(N3CCOCC3)n2c1.
What is the InChIKey of 4-imidazo[1,2-a]pyrimidin-3-ylmorpholine?
The InChIKey is VRMFYNIJJLOGEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O/c1-2-11-10-12-8-9(14(10)3-1)13-4-6-15-7-5-13/h1-3,8H,4-7H2.
What are the key properties of 4-imidazo[1,2-a]pyrimidin-3-ylmorpholine?
4-imidazo[1,2-a]pyrimidin-3-ylmorpholine has a molecular weight of 204.23 g/mol, XLogP of 0.57, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imidazo[1,2-a]pyrimidin-3-ylmorpholine is sourced from PubChem (CID 3757823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).