C21H17BrN4O2 — CID 3758915
6-[(4-bromophenyl)methylideneamino]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 3758915) has the molecular formula C21H17BrN4O2 and a molecular weight of 437.30 g/mol. Its IUPAC name is 6-[(4-bromophenyl)methylideneamino]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | 6-[(4-bromophenyl)methylideneamino]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 3758915 |
| Molecular Formula | C21H17BrN4O2 |
| Molecular Weight | 437.30 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 6-[(4-bromophenyl)methylideneamino]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | O=C1C2Cc3c([nH]c4ccccc34)CN2C(=O)CN1N=Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C21H17BrN4O2/c22-14-7-5-13(6-8-14)10-23-26-12-20(27)25-11-18-16(9-19(25)21(26)28)15-3-1-2-4-17(15)24-18/h1-8,10,19,24H,9,11-12H2 |
| InChIKey | XWMPPGDKNKMFAU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|