C11H6O3S2 — CID 375903
2-(Hydroxymethyl)benzo[1,2-b:5,4-b']bisthiophene-4,8-dione (PubChem CID 375903) has the molecular formula C11H6O3S2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 2-(hydroxymethyl)thieno[3,2-f][1]benzothiole-4,8-dione.
| Compound Name | 2-(Hydroxymethyl)benzo[1,2-b:5,4-b']bisthiophene-4,8-dione |
|---|---|
| PubChem CID | 375903 |
| Molecular Formula | C11H6O3S2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 249.98 |
| IUPAC Name | 2-(hydroxymethyl)thieno[3,2-f][1]benzothiole-4,8-dione |
| SMILES | C1=CSC2=C1C(=O)C3=C(C2=O)SC(=C3)CO |
| InChI | InChI=1S/C11H6O3S2/c12-4-5-3-7-8(13)6-1-2-15-10(6)9(14)11(7)16-5/h1-3,12H,4H2 |
| InChIKey | TWAZIKADPMNERA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 111.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | 344 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|