C14H17N3 — CID 3759084
1,6,8-trimethyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-amine (PubChem CID 3759084) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is 1,6,8-trimethyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-amine.
| Compound Name | 1,6,8-trimethyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-amine |
|---|---|
| PubChem CID | 3759084 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 1,6,8-trimethyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-amine |
| SMILES | Cc1cc(C)c2nc3c(c(N)c2c1)CCN3C |
| InChI | InChI=1S/C14H17N3/c1-8-6-9(2)13-11(7-8)12(15)10-4-5-17(3)14(10)16-13/h6-7H,4-5H2,1-3H3,(H2,15,16) |
| InChIKey | PKPMHXAOKQVULU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |