About 2-(4-methoxyphenoxy)-4,8-dimethylquinoline
2-(4-methoxyphenoxy)-4,8-dimethylquinoline (PubChem CID 3759611) has the molecular formula C18H17NO2
and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-(4-methoxyphenoxy)-4,8-dimethylquinoline.
Molecular Properties
| Compound Name | 2-(4-methoxyphenoxy)-4,8-dimethylquinoline |
| PubChem CID | 3759611 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-(4-methoxyphenoxy)-4,8-dimethylquinoline |
| SMILES | COc1ccc(Oc2cc(C)c3cccc(C)c3n2)cc1 |
| InChI | InChI=1S/C18H17NO2/c1-12-5-4-6-16-13(2)11-17(19-18(12)16)21-15-9-7-14(20-3)8-10-15/h4-11H,1-3H3 |
| InChIKey | LMJNOIVZHRPHEQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-methoxyphenoxy)-4,8-dimethylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxyphenoxy)-4,8-dimethylquinoline?
The IUPAC name of 2-(4-methoxyphenoxy)-4,8-dimethylquinoline (CID 3759611) is 2-(4-methoxyphenoxy)-4,8-dimethylquinoline.
What is the SMILES notation for 2-(4-methoxyphenoxy)-4,8-dimethylquinoline?
The canonical SMILES for 2-(4-methoxyphenoxy)-4,8-dimethylquinoline is COc1ccc(Oc2cc(C)c3cccc(C)c3n2)cc1.
What is the InChIKey of 2-(4-methoxyphenoxy)-4,8-dimethylquinoline?
The InChIKey is LMJNOIVZHRPHEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO2/c1-12-5-4-6-16-13(2)11-17(19-18(12)16)21-15-9-7-14(20-3)8-10-15/h4-11H,1-3H3.
What are the key properties of 2-(4-methoxyphenoxy)-4,8-dimethylquinoline?
2-(4-methoxyphenoxy)-4,8-dimethylquinoline has a molecular weight of 279.34 g/mol, XLogP of 4.65, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxyphenoxy)-4,8-dimethylquinoline is sourced from PubChem (CID 3759611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).