C19H33N3O3 — CID 3760075
1-N,3-N-diethoxy-5,5-dimethyl-2-(N-prop-2-enoxy-C-propylcarbonimidoyl)cyclohexane-1,3-diimine (PubChem CID 3760075) has the molecular formula C19H33N3O3 and a molecular weight of 351.49 g/mol. Its IUPAC name is 1-N,3-N-diethoxy-5,5-dimethyl-2-(N-prop-2-enoxy-C-propylcarbonimidoyl)cyclohexane-1,3-diimine.
| Compound Name | 1-N,3-N-diethoxy-5,5-dimethyl-2-(N-prop-2-enoxy-C-propylcarbonimidoyl)cyclohexane-1,3-diimine |
|---|---|
| PubChem CID | 3760075 |
| Molecular Formula | C19H33N3O3 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.25 |
| IUPAC Name | 1-N,3-N-diethoxy-5,5-dimethyl-2-(N-prop-2-enoxy-C-propylcarbonimidoyl)cyclohexane-1,3-diimine |
| SMILES | C=CCON=C(CCC)C1C(=NOCC)CC(C)(C)CC1=NOCC |
| InChI | InChI=1S/C19H33N3O3/c1-7-11-15(20-25-12-8-2)18-16(21-23-9-3)13-19(5,6)14-17(18)22-24-10-4/h8,18H,2,7,9-14H2,1,3-6H3 |
| InChIKey | VVKYCMXPCMOVKQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 64.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|