C7H3F3N2OS — CID 3760850
6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde (PubChem CID 3760850) has the molecular formula C7H3F3N2OS and a molecular weight of 220.18 g/mol. Its IUPAC name is 6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde.
| Compound Name | 6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 3760850 |
| Molecular Formula | C7H3F3N2OS |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 219.99 |
| IUPAC Name | 6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| SMILES | O=Cc1c(C(F)(F)F)nc2sccn12 |
| InChI | InChI=1S/C7H3F3N2OS/c8-7(9,10)5-4(3-13)12-1-2-14-6(12)11-5/h1-3H |
| InChIKey | UZNYVYBQRNSEGZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|