About N-(oxolan-2-ylmethyl)-1,3-benzothiazol-2-amine
N-(oxolan-2-ylmethyl)-1,3-benzothiazol-2-amine (PubChem CID 3761548) has the molecular formula C12H14N2OS
and a molecular weight of 234.32 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-1,3-benzothiazol-2-amine.
Molecular Properties
| Compound Name | N-(oxolan-2-ylmethyl)-1,3-benzothiazol-2-amine |
| PubChem CID | 3761548 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-1,3-benzothiazol-2-amine |
| SMILES | c1ccc2sc(NCC3CCCO3)nc2c1 |
| InChI | InChI=1S/C12H14N2OS/c1-2-6-11-10(5-1)14-12(16-11)13-8-9-4-3-7-15-9/h1-2,5-6,9H,3-4,7-8H2,(H,13,14) |
| InChIKey | ZBYZZQOXZMQOCI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(oxolan-2-ylmethyl)-1,3-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(oxolan-2-ylmethyl)-1,3-benzothiazol-2-amine?
The IUPAC name of N-(oxolan-2-ylmethyl)-1,3-benzothiazol-2-amine (CID 3761548) is N-(oxolan-2-ylmethyl)-1,3-benzothiazol-2-amine.
What is the SMILES notation for N-(oxolan-2-ylmethyl)-1,3-benzothiazol-2-amine?
The canonical SMILES for N-(oxolan-2-ylmethyl)-1,3-benzothiazol-2-amine is c1ccc2sc(NCC3CCCO3)nc2c1.
What is the InChIKey of N-(oxolan-2-ylmethyl)-1,3-benzothiazol-2-amine?
The InChIKey is ZBYZZQOXZMQOCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2OS/c1-2-6-11-10(5-1)14-12(16-11)13-8-9-4-3-7-15-9/h1-2,5-6,9H,3-4,7-8H2,(H,13,14).
What are the key properties of N-(oxolan-2-ylmethyl)-1,3-benzothiazol-2-amine?
N-(oxolan-2-ylmethyl)-1,3-benzothiazol-2-amine has a molecular weight of 234.32 g/mol, XLogP of 2.89, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(oxolan-2-ylmethyl)-1,3-benzothiazol-2-amine is sourced from PubChem (CID 3761548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).