C11H17N3O5S — CID 3761798
5-[(3-amino-3-carboxypropyl)-methylsulfonio]-1,3-dimethyl-2,6-dioxopyrimidin-4-olate (PubChem CID 3761798) has the molecular formula C11H17N3O5S and a molecular weight of 303.34 g/mol. Its IUPAC name is 5-[(3-amino-3-carboxypropyl)-methylsulfonio]-1,3-dimethyl-2,6-dioxopyrimidin-4-olate.
| Compound Name | 5-[(3-amino-3-carboxypropyl)-methylsulfonio]-1,3-dimethyl-2,6-dioxopyrimidin-4-olate |
|---|---|
| PubChem CID | 3761798 |
| Molecular Formula | C11H17N3O5S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 5-[(3-amino-3-carboxypropyl)-methylsulfonio]-1,3-dimethyl-2,6-dioxopyrimidin-4-olate |
| SMILES | Cn1c([O-])c([S+](C)CCC(N)C(=O)O)c(=O)n(C)c1=O |
| InChI | InChI=1S/C11H17N3O5S/c1-13-8(15)7(9(16)14(2)11(13)19)20(3)5-4-6(12)10(17)18/h6H,4-5,12H2,1-3H3,(H-,15,16,17,18) |
| InChIKey | QPYWDEBBLFBZMU-UHFFFAOYSA-N |
| XLogP | -2.43 |
| TPSA | 130.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|