C11H18N3O5S+ — CID 3761799
(3-amino-3-carboxypropyl)-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-methylsulfanium (PubChem CID 3761799) has the molecular formula C11H18N3O5S+ and a molecular weight of 304.35 g/mol. Its IUPAC name is (3-amino-3-carboxypropyl)-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-methylsulfanium.
| Compound Name | (3-amino-3-carboxypropyl)-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-methylsulfanium |
|---|---|
| PubChem CID | 3761799 |
| Molecular Formula | C11H18N3O5S+ |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | (3-amino-3-carboxypropyl)-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-methylsulfanium |
| SMILES | Cn1c(O)c([S+](C)CCC(N)C(=O)O)c(=O)n(C)c1=O |
| InChI | InChI=1S/C11H17N3O5S/c1-13-8(15)7(9(16)14(2)11(13)19)20(3)5-4-6(12)10(17)18/h6H,4-5,12H2,1-3H3,(H-,15,16,17,18)/p+1 |
| InChIKey | QPYWDEBBLFBZMU-UHFFFAOYSA-O |
| XLogP | -1.80 |
| TPSA | 127.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|