C28H31N3O6S — CID 3761999
[4-(3-oxo-11-propan-2-yl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-5-yl)phenyl] 3,4,5-trimethoxybenzoate (PubChem CID 3761999) has the molecular formula C28H31N3O6S and a molecular weight of 537.64 g/mol. Its IUPAC name is [4-(3-oxo-11-propan-2-yl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-5-yl)phenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [4-(3-oxo-11-propan-2-yl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-5-yl)phenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 3761999 |
| Molecular Formula | C28H31N3O6S |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | [4-(3-oxo-11-propan-2-yl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7)-dien-5-yl)phenyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2ccc(C3NC(=O)c4c(sc5c4CCN(C(C)C)C5)N3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C28H31N3O6S/c1-15(2)31-11-10-19-22(14-31)38-27-23(19)26(32)29-25(30-27)16-6-8-18(9-7-16)37-28(33)17-12-20(34-3)24(36-5)21(13-17)35-4/h6-9,12-13,15,25,30H,10-11,14H2,1-5H3,(H,29,32) |
| InChIKey | KCYDPBMBFFUBTM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|