C15H15ClN2O4S — CID 3762660
[3-[(4-chlorophenyl)carbamoyl]phenyl] N,N-dimethylsulfamate (PubChem CID 3762660) has the molecular formula C15H15ClN2O4S and a molecular weight of 354.82 g/mol. Its IUPAC name is [3-[(4-chlorophenyl)carbamoyl]phenyl] N,N-dimethylsulfamate.
| Compound Name | [3-[(4-chlorophenyl)carbamoyl]phenyl] N,N-dimethylsulfamate |
|---|---|
| PubChem CID | 3762660 |
| Molecular Formula | C15H15ClN2O4S |
| Molecular Weight | 354.82 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | [3-[(4-chlorophenyl)carbamoyl]phenyl] N,N-dimethylsulfamate |
| SMILES | CN(C)S(=O)(=O)Oc1cccc(C(=O)Nc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C15H15ClN2O4S/c1-18(2)23(20,21)22-14-5-3-4-11(10-14)15(19)17-13-8-6-12(16)7-9-13/h3-10H,1-2H3,(H,17,19) |
| InChIKey | HEVAISJKFSCVHX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.82 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |