About 2,6-dimethylpyrylium
2,6-dimethylpyrylium (PubChem CID 3763156) has the molecular formula C7H9O+
and a molecular weight of 109.15 g/mol. Its IUPAC name is 2,6-dimethylpyrylium.
Molecular Properties
| Compound Name | 2,6-dimethylpyrylium |
| PubChem CID | 3763156 |
| Molecular Formula | C7H9O+ |
| Molecular Weight | 109.15 g/mol |
| Exact Mass | 109.06 |
| IUPAC Name | 2,6-dimethylpyrylium |
| SMILES | Cc1cccc(C)[o+]1 |
| InChI | InChI=1S/C7H9O/c1-6-4-3-5-7(2)8-6/h3-5H,1-2H3/q+1 |
| InChIKey | AMDMKDYOYXQSMN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.15 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethylpyrylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethylpyrylium?
The IUPAC name of 2,6-dimethylpyrylium (CID 3763156) is 2,6-dimethylpyrylium.
What is the SMILES notation for 2,6-dimethylpyrylium?
The canonical SMILES for 2,6-dimethylpyrylium is Cc1cccc(C)[o+]1.
What is the InChIKey of 2,6-dimethylpyrylium?
The InChIKey is AMDMKDYOYXQSMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9O/c1-6-4-3-5-7(2)8-6/h3-5H,1-2H3/q+1.
What are the key properties of 2,6-dimethylpyrylium?
2,6-dimethylpyrylium has a molecular weight of 109.15 g/mol, XLogP of 2.18, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethylpyrylium is sourced from PubChem (CID 3763156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).