About Adinazolam
Adinazolam (PubChem CID 37632) has the molecular formula C19H18ClN5
and a molecular weight of 351.80 g/mol. Its IUPAC name is 1-(8-chloro-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl)-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | Adinazolam |
| PubChem CID | 37632 |
| Molecular Formula | C19H18ClN5 |
| Molecular Weight | 351.80 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 1-(8-chloro-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl)-N,N-dimethylmethanamine |
| SMILES | CN(C)CC1=NN=C2N1C3=C(C=C(C=C3)Cl)C(=NC2)C4=CC=CC=C4 |
| InChI | InChI=1S/C19H18ClN5/c1-24(2)12-18-23-22-17-11-21-19(13-6-4-3-5-7-13)15-10-14(20)8-9-16(15)25(17)18/h3-10H,11-12H2,1-2H3 |
| InChIKey | GJSLOMWRLALDCT-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 46.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | 490 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.80 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze Adinazolam with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Adinazolam?
The IUPAC name of Adinazolam (CID 37632) is 1-(8-chloro-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl)-N,N-dimethylmethanamine.
What is the SMILES notation for Adinazolam?
The canonical SMILES for Adinazolam is CN(C)CC1=NN=C2N1C3=C(C=C(C=C3)Cl)C(=NC2)C4=CC=CC=C4.
What is the InChIKey of Adinazolam?
The InChIKey is GJSLOMWRLALDCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18ClN5/c1-24(2)12-18-23-22-17-11-21-19(13-6-4-3-5-7-13)15-10-14(20)8-9-16(15)25(17)18/h3-10H,11-12H2,1-2H3.
What are the key properties of Adinazolam?
Adinazolam has a molecular weight of 351.80 g/mol, XLogP of 1.60, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Adinazolam is sourced from PubChem (CID 37632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).