About 2-amino-3-methyl-1-(1,4,7-trioxa-10-azacyclododec-10-yl)butan-1-one
2-amino-3-methyl-1-(1,4,7-trioxa-10-azacyclododec-10-yl)butan-1-one (PubChem CID 3763341) has the molecular formula C13H26N2O4
and a molecular weight of 274.36 g/mol. Its IUPAC name is 2-amino-3-methyl-1-(1,4,7-trioxa-10-azacyclododec-10-yl)butan-1-one.
Molecular Properties
| Compound Name | 2-amino-3-methyl-1-(1,4,7-trioxa-10-azacyclododec-10-yl)butan-1-one |
| PubChem CID | 3763341 |
| Molecular Formula | C13H26N2O4 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 2-amino-3-methyl-1-(1,4,7-trioxa-10-azacyclododec-10-yl)butan-1-one |
| SMILES | CC(C)C(N)C(=O)N1CCOCCOCCOCC1 |
| InChI | InChI=1S/C13H26N2O4/c1-11(2)12(14)13(16)15-3-5-17-7-9-19-10-8-18-6-4-15/h11-12H,3-10,14H2,1-2H3 |
| InChIKey | CVFYXCAXFRDKNY-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-3-methyl-1-(1,4,7-trioxa-10-azacyclododec-10-yl)butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-methyl-1-(1,4,7-trioxa-10-azacyclododec-10-yl)butan-1-one?
The IUPAC name of 2-amino-3-methyl-1-(1,4,7-trioxa-10-azacyclododec-10-yl)butan-1-one (CID 3763341) is 2-amino-3-methyl-1-(1,4,7-trioxa-10-azacyclododec-10-yl)butan-1-one.
What is the SMILES notation for 2-amino-3-methyl-1-(1,4,7-trioxa-10-azacyclododec-10-yl)butan-1-one?
The canonical SMILES for 2-amino-3-methyl-1-(1,4,7-trioxa-10-azacyclododec-10-yl)butan-1-one is CC(C)C(N)C(=O)N1CCOCCOCCOCC1.
What is the InChIKey of 2-amino-3-methyl-1-(1,4,7-trioxa-10-azacyclododec-10-yl)butan-1-one?
The InChIKey is CVFYXCAXFRDKNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O4/c1-11(2)12(14)13(16)15-3-5-17-7-9-19-10-8-18-6-4-15/h11-12H,3-10,14H2,1-2H3.
What are the key properties of 2-amino-3-methyl-1-(1,4,7-trioxa-10-azacyclododec-10-yl)butan-1-one?
2-amino-3-methyl-1-(1,4,7-trioxa-10-azacyclododec-10-yl)butan-1-one has a molecular weight of 274.36 g/mol, XLogP of -0.14, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-methyl-1-(1,4,7-trioxa-10-azacyclododec-10-yl)butan-1-one is sourced from PubChem (CID 3763341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).