About 2-methylpropyl 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoate
2-methylpropyl 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoate (PubChem CID 3763617) has the molecular formula C20H23NO4
and a molecular weight of 341.41 g/mol. Its IUPAC name is 2-methylpropyl 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoate.
Molecular Properties
| Compound Name | 2-methylpropyl 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoate |
| PubChem CID | 3763617 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 2-methylpropyl 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoate |
| SMILES | CC(C)COC(=O)c1ccccc1N1C(=O)C2C3CCC(C3)C2C1=O |
| InChI | InChI=1S/C20H23NO4/c1-11(2)10-25-20(24)14-5-3-4-6-15(14)21-18(22)16-12-7-8-13(9-12)17(16)19(21)23/h3-6,11-13,16-17H,7-10H2,1-2H3 |
| InChIKey | SQPYKOKJWNDWRA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoate?
The IUPAC name of 2-methylpropyl 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoate (CID 3763617) is 2-methylpropyl 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoate.
What is the SMILES notation for 2-methylpropyl 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoate?
The canonical SMILES for 2-methylpropyl 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoate is CC(C)COC(=O)c1ccccc1N1C(=O)C2C3CCC(C3)C2C1=O.
What is the InChIKey of 2-methylpropyl 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoate?
The InChIKey is SQPYKOKJWNDWRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO4/c1-11(2)10-25-20(24)14-5-3-4-6-15(14)21-18(22)16-12-7-8-13(9-12)17(16)19(21)23/h3-6,11-13,16-17H,7-10H2,1-2H3.
What are the key properties of 2-methylpropyl 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoate?
2-methylpropyl 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoate has a molecular weight of 341.41 g/mol, XLogP of 3.03, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoate is sourced from PubChem (CID 3763617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).