C19H15F3N6O6 — CID 3763904
N'-[2,6-dinitro-4-(trifluoromethyl)phenyl]-N-(5-nitroquinolin-8-yl)propane-1,3-diamine (PubChem CID 3763904) has the molecular formula C19H15F3N6O6 and a molecular weight of 480.36 g/mol. Its IUPAC name is N'-[2,6-dinitro-4-(trifluoromethyl)phenyl]-N-(5-nitroquinolin-8-yl)propane-1,3-diamine.
| Compound Name | N'-[2,6-dinitro-4-(trifluoromethyl)phenyl]-N-(5-nitroquinolin-8-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 3763904 |
| Molecular Formula | C19H15F3N6O6 |
| Molecular Weight | 480.36 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | N'-[2,6-dinitro-4-(trifluoromethyl)phenyl]-N-(5-nitroquinolin-8-yl)propane-1,3-diamine |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1NCCCNc1ccc([N+](=O)[O-])c2cccnc12 |
| InChI | InChI=1S/C19H15F3N6O6/c20-19(21,22)11-9-15(27(31)32)18(16(10-11)28(33)34)25-8-2-7-23-13-4-5-14(26(29)30)12-3-1-6-24-17(12)13/h1,3-6,9-10,23,25H,2,7-8H2 |
| InChIKey | LKTROXDHPNVMHN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 166.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.36 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|