About 5-(4-bromo-2,5-diethoxyphenyl)-4-iodo-1H-pyrazol-3-amine
5-(4-bromo-2,5-diethoxyphenyl)-4-iodo-1H-pyrazol-3-amine (PubChem CID 3764216) has the molecular formula C13H15BrIN3O2
and a molecular weight of 452.09 g/mol. Its IUPAC name is 5-(4-bromo-2,5-diethoxyphenyl)-4-iodo-1H-pyrazol-3-amine.
Molecular Properties
| Compound Name | 5-(4-bromo-2,5-diethoxyphenyl)-4-iodo-1H-pyrazol-3-amine |
| PubChem CID | 3764216 |
| Molecular Formula | C13H15BrIN3O2 |
| Molecular Weight | 452.09 g/mol |
| Exact Mass | 450.94 |
| IUPAC Name | 5-(4-bromo-2,5-diethoxyphenyl)-4-iodo-1H-pyrazol-3-amine |
| SMILES | CCOc1cc(-c2[nH]nc(N)c2I)c(OCC)cc1Br |
| InChI | InChI=1S/C13H15BrIN3O2/c1-3-19-9-6-8(14)10(20-4-2)5-7(9)12-11(15)13(16)18-17-12/h5-6H,3-4H2,1-2H3,(H3,16,17,18) |
| InChIKey | YRRMVXGJPVAUJQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.09 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-bromo-2,5-diethoxyphenyl)-4-iodo-1H-pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-bromo-2,5-diethoxyphenyl)-4-iodo-1H-pyrazol-3-amine?
The IUPAC name of 5-(4-bromo-2,5-diethoxyphenyl)-4-iodo-1H-pyrazol-3-amine (CID 3764216) is 5-(4-bromo-2,5-diethoxyphenyl)-4-iodo-1H-pyrazol-3-amine.
What is the SMILES notation for 5-(4-bromo-2,5-diethoxyphenyl)-4-iodo-1H-pyrazol-3-amine?
The canonical SMILES for 5-(4-bromo-2,5-diethoxyphenyl)-4-iodo-1H-pyrazol-3-amine is CCOc1cc(-c2[nH]nc(N)c2I)c(OCC)cc1Br.
What is the InChIKey of 5-(4-bromo-2,5-diethoxyphenyl)-4-iodo-1H-pyrazol-3-amine?
The InChIKey is YRRMVXGJPVAUJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15BrIN3O2/c1-3-19-9-6-8(14)10(20-4-2)5-7(9)12-11(15)13(16)18-17-12/h5-6H,3-4H2,1-2H3,(H3,16,17,18).
What are the key properties of 5-(4-bromo-2,5-diethoxyphenyl)-4-iodo-1H-pyrazol-3-amine?
5-(4-bromo-2,5-diethoxyphenyl)-4-iodo-1H-pyrazol-3-amine has a molecular weight of 452.09 g/mol, XLogP of 3.82, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-bromo-2,5-diethoxyphenyl)-4-iodo-1H-pyrazol-3-amine is sourced from PubChem (CID 3764216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).