C15H12Cl2N4O5 — CID 3764827
ethyl 7-(3,4-dichlorophenyl)-1-nitroso-6,8-dioxo-1,2,7-triazaspiro[4.4]non-2-ene-3-carboxylate (PubChem CID 3764827) has the molecular formula C15H12Cl2N4O5 and a molecular weight of 399.19 g/mol. Its IUPAC name is ethyl 7-(3,4-dichlorophenyl)-1-nitroso-6,8-dioxo-1,2,7-triazaspiro[4.4]non-2-ene-3-carboxylate.
| Compound Name | ethyl 7-(3,4-dichlorophenyl)-1-nitroso-6,8-dioxo-1,2,7-triazaspiro[4.4]non-2-ene-3-carboxylate |
|---|---|
| PubChem CID | 3764827 |
| Molecular Formula | C15H12Cl2N4O5 |
| Molecular Weight | 399.19 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | ethyl 7-(3,4-dichlorophenyl)-1-nitroso-6,8-dioxo-1,2,7-triazaspiro[4.4]non-2-ene-3-carboxylate |
| SMILES | CCOC(=O)C1=NN(N=O)C2(CC(=O)N(c3ccc(Cl)c(Cl)c3)C2=O)C1 |
| InChI | InChI=1S/C15H12Cl2N4O5/c1-2-26-13(23)11-6-15(21(18-11)19-25)7-12(22)20(14(15)24)8-3-4-9(16)10(17)5-8/h3-5H,2,6-7H2,1H3 |
| InChIKey | IXTAUULQVXKRPO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 108.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.19 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|