C13H16F3N3O3 — CID 3765015
methyl 3,3,3-trifluoro-2-[(6-methyl-2-pyridinyl)amino]-2-(propanoylamino)propanoate (PubChem CID 3765015) has the molecular formula C13H16F3N3O3 and a molecular weight of 319.28 g/mol. Its IUPAC name is methyl 3,3,3-trifluoro-2-[(6-methyl-2-pyridinyl)amino]-2-(propanoylamino)propanoate.
| Compound Name | methyl 3,3,3-trifluoro-2-[(6-methyl-2-pyridinyl)amino]-2-(propanoylamino)propanoate |
|---|---|
| PubChem CID | 3765015 |
| Molecular Formula | C13H16F3N3O3 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | methyl 3,3,3-trifluoro-2-[(6-methyl-2-pyridinyl)amino]-2-(propanoylamino)propanoate |
| SMILES | CCC(=O)NC(Nc1cccc(C)n1)(C(=O)OC)C(F)(F)F |
| InChI | InChI=1S/C13H16F3N3O3/c1-4-10(20)19-12(11(21)22-3,13(14,15)16)18-9-7-5-6-8(2)17-9/h5-7H,4H2,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | KOBSDOKGKQIHLX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|