C22H24N2O4S — CID 3765229
N-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]-N-(oxolan-2-ylmethyl)benzenesulfonamide (PubChem CID 3765229) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is N-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]-N-(oxolan-2-ylmethyl)benzenesulfonamide.
| Compound Name | N-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]-N-(oxolan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3765229 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | N-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]-N-(oxolan-2-ylmethyl)benzenesulfonamide |
| SMILES | Cc1ccc2cc(CN(CC3CCCO3)S(=O)(=O)c3ccccc3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C22H24N2O4S/c1-16-9-10-17-13-18(22(25)23-21(17)12-16)14-24(15-19-6-5-11-28-19)29(26,27)20-7-3-2-4-8-20/h2-4,7-10,12-13,19H,5-6,11,14-15H2,1H3,(H,23,25) |
| InChIKey | MZXRPHZYGOYLOH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |