About 2-phenylimidazo[2,1-a]phthalazin-6-amine
2-phenylimidazo[2,1-a]phthalazin-6-amine (PubChem CID 3765310) has the molecular formula C16H12N4
and a molecular weight of 260.30 g/mol. Its IUPAC name is 2-phenylimidazo[2,1-a]phthalazin-6-amine.
Molecular Properties
| Compound Name | 2-phenylimidazo[2,1-a]phthalazin-6-amine |
| PubChem CID | 3765310 |
| Molecular Formula | C16H12N4 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-phenylimidazo[2,1-a]phthalazin-6-amine |
| SMILES | Nc1nn2cc(-c3ccccc3)nc2c2ccccc12 |
| InChI | InChI=1S/C16H12N4/c17-15-12-8-4-5-9-13(12)16-18-14(10-20(16)19-15)11-6-2-1-3-7-11/h1-10H,(H2,17,19) |
| InChIKey | FPZLJNFFUADCKW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-phenylimidazo[2,1-a]phthalazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylimidazo[2,1-a]phthalazin-6-amine?
The IUPAC name of 2-phenylimidazo[2,1-a]phthalazin-6-amine (CID 3765310) is 2-phenylimidazo[2,1-a]phthalazin-6-amine.
What is the SMILES notation for 2-phenylimidazo[2,1-a]phthalazin-6-amine?
The canonical SMILES for 2-phenylimidazo[2,1-a]phthalazin-6-amine is Nc1nn2cc(-c3ccccc3)nc2c2ccccc12.
What is the InChIKey of 2-phenylimidazo[2,1-a]phthalazin-6-amine?
The InChIKey is FPZLJNFFUADCKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N4/c17-15-12-8-4-5-9-13(12)16-18-14(10-20(16)19-15)11-6-2-1-3-7-11/h1-10H,(H2,17,19).
What are the key properties of 2-phenylimidazo[2,1-a]phthalazin-6-amine?
2-phenylimidazo[2,1-a]phthalazin-6-amine has a molecular weight of 260.30 g/mol, XLogP of 3.13, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylimidazo[2,1-a]phthalazin-6-amine is sourced from PubChem (CID 3765310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).