C27H19ClF4N2O2 — CID 3765568
9-(4-chlorophenyl)-6-(4-fluorophenyl)-5-(2,2,2-trifluoroacetyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one (PubChem CID 3765568) has the molecular formula C27H19ClF4N2O2 and a molecular weight of 514.91 g/mol. Its IUPAC name is 9-(4-chlorophenyl)-6-(4-fluorophenyl)-5-(2,2,2-trifluoroacetyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 9-(4-chlorophenyl)-6-(4-fluorophenyl)-5-(2,2,2-trifluoroacetyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 3765568 |
| Molecular Formula | C27H19ClF4N2O2 |
| Molecular Weight | 514.91 g/mol |
| Exact Mass | 514.11 |
| IUPAC Name | 9-(4-chlorophenyl)-6-(4-fluorophenyl)-5-(2,2,2-trifluoroacetyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
| SMILES | O=C1CC(c2ccc(Cl)cc2)CC2=C1C(c1ccc(F)cc1)N(C(=O)C(F)(F)F)c1ccccc1N2 |
| InChI | InChI=1S/C27H19ClF4N2O2/c28-18-9-5-15(6-10-18)17-13-21-24(23(35)14-17)25(16-7-11-19(29)12-8-16)34(26(36)27(30,31)32)22-4-2-1-3-20(22)33-21/h1-12,17,25,33H,13-14H2 |
| InChIKey | TXDKRWZQCFVRSL-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.91 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |