C26H27N7O3 — CID 3765831
1-[4-[1-(benzotriazol-1-ylmethyl)imidazol-2-yl]piperidin-1-yl]-2-[(3-nitrophenyl)methylidene]butan-1-one (PubChem CID 3765831) has the molecular formula C26H27N7O3 and a molecular weight of 485.55 g/mol. Its IUPAC name is 1-[4-[1-(benzotriazol-1-ylmethyl)imidazol-2-yl]piperidin-1-yl]-2-[(3-nitrophenyl)methylidene]butan-1-one.
| Compound Name | 1-[4-[1-(benzotriazol-1-ylmethyl)imidazol-2-yl]piperidin-1-yl]-2-[(3-nitrophenyl)methylidene]butan-1-one |
|---|---|
| PubChem CID | 3765831 |
| Molecular Formula | C26H27N7O3 |
| Molecular Weight | 485.55 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | 1-[4-[1-(benzotriazol-1-ylmethyl)imidazol-2-yl]piperidin-1-yl]-2-[(3-nitrophenyl)methylidene]butan-1-one |
| SMILES | CCC(=Cc1cccc([N+](=O)[O-])c1)C(=O)N1CCC(c2nccn2Cn2nnc3ccccc32)CC1 |
| InChI | InChI=1S/C26H27N7O3/c1-2-20(16-19-6-5-7-22(17-19)33(35)36)26(34)30-13-10-21(11-14-30)25-27-12-15-31(25)18-32-24-9-4-3-8-23(24)28-29-32/h3-9,12,15-17,21H,2,10-11,13-14,18H2,1H3 |
| InChIKey | ZQYAZYLKWQYZIY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 111.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|