About 1-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-(2-fluorophenyl)urea
1-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-(2-fluorophenyl)urea (PubChem CID 3765920) has the molecular formula C11H11FN4OS2
and a molecular weight of 298.37 g/mol. Its IUPAC name is 1-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-(2-fluorophenyl)urea.
Molecular Properties
| Compound Name | 1-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-(2-fluorophenyl)urea |
| PubChem CID | 3765920 |
| Molecular Formula | C11H11FN4OS2 |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 1-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-(2-fluorophenyl)urea |
| SMILES | CCSc1nsc(NC(=O)Nc2ccccc2F)n1 |
| InChI | InChI=1S/C11H11FN4OS2/c1-2-18-11-15-10(19-16-11)14-9(17)13-8-6-4-3-5-7(8)12/h3-6H,2H2,1H3,(H2,13,14,15,16,17) |
| InChIKey | KPUUVSPVOMJJFG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-(2-fluorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-(2-fluorophenyl)urea?
The IUPAC name of 1-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-(2-fluorophenyl)urea (CID 3765920) is 1-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-(2-fluorophenyl)urea.
What is the SMILES notation for 1-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-(2-fluorophenyl)urea?
The canonical SMILES for 1-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-(2-fluorophenyl)urea is CCSc1nsc(NC(=O)Nc2ccccc2F)n1.
What is the InChIKey of 1-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-(2-fluorophenyl)urea?
The InChIKey is KPUUVSPVOMJJFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FN4OS2/c1-2-18-11-15-10(19-16-11)14-9(17)13-8-6-4-3-5-7(8)12/h3-6H,2H2,1H3,(H2,13,14,15,16,17).
What are the key properties of 1-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-(2-fluorophenyl)urea?
1-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-(2-fluorophenyl)urea has a molecular weight of 298.37 g/mol, XLogP of 3.43, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-(2-fluorophenyl)urea is sourced from PubChem (CID 3765920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).