C45H48O3 — CID 3766004
[3,5-bis(4-cyclohexylbenzoyl)phenyl]-(4-cyclohexylphenyl)methanone (PubChem CID 3766004) has the molecular formula C45H48O3 and a molecular weight of 636.88 g/mol. Its IUPAC name is [3,5-bis(4-cyclohexylbenzoyl)phenyl]-(4-cyclohexylphenyl)methanone.
| Compound Name | [3,5-bis(4-cyclohexylbenzoyl)phenyl]-(4-cyclohexylphenyl)methanone |
|---|---|
| PubChem CID | 3766004 |
| Molecular Formula | C45H48O3 |
| Molecular Weight | 636.88 g/mol |
| Exact Mass | 636.36 |
| IUPAC Name | [3,5-bis(4-cyclohexylbenzoyl)phenyl]-(4-cyclohexylphenyl)methanone |
| SMILES | O=C(c1ccc(C2CCCCC2)cc1)c1cc(C(=O)c2ccc(C3CCCCC3)cc2)cc(C(=O)c2ccc(C3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C45H48O3/c46-43(37-22-16-34(17-23-37)31-10-4-1-5-11-31)40-28-41(44(47)38-24-18-35(19-25-38)32-12-6-2-7-13-32)30-42(29-40)45(48)39-26-20-36(21-27-39)33-14-8-3-9-15-33/h16-33H,1-15H2 |
| InChIKey | PDTLEOIBTRZVQV-UHFFFAOYSA-N |
| XLogP | 11.52 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.88 |
| LogP ≤ 5 | 11.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |