About 3-octyl-1,3-benzothiazol-2-one
3-octyl-1,3-benzothiazol-2-one (PubChem CID 3766804) has the molecular formula C15H21NOS
and a molecular weight of 263.41 g/mol. Its IUPAC name is 3-octyl-1,3-benzothiazol-2-one.
Molecular Properties
| Compound Name | 3-octyl-1,3-benzothiazol-2-one |
| PubChem CID | 3766804 |
| Molecular Formula | C15H21NOS |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 3-octyl-1,3-benzothiazol-2-one |
| SMILES | CCCCCCCCn1c(=O)sc2ccccc21 |
| InChI | InChI=1S/C15H21NOS/c1-2-3-4-5-6-9-12-16-13-10-7-8-11-14(13)18-15(16)17/h7-8,10-11H,2-6,9,12H2,1H3 |
| InChIKey | KGCWETJBQMJRRC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-octyl-1,3-benzothiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-octyl-1,3-benzothiazol-2-one?
The IUPAC name of 3-octyl-1,3-benzothiazol-2-one (CID 3766804) is 3-octyl-1,3-benzothiazol-2-one.
What is the SMILES notation for 3-octyl-1,3-benzothiazol-2-one?
The canonical SMILES for 3-octyl-1,3-benzothiazol-2-one is CCCCCCCCn1c(=O)sc2ccccc21.
What is the InChIKey of 3-octyl-1,3-benzothiazol-2-one?
The InChIKey is KGCWETJBQMJRRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NOS/c1-2-3-4-5-6-9-12-16-13-10-7-8-11-14(13)18-15(16)17/h7-8,10-11H,2-6,9,12H2,1H3.
What are the key properties of 3-octyl-1,3-benzothiazol-2-one?
3-octyl-1,3-benzothiazol-2-one has a molecular weight of 263.41 g/mol, XLogP of 4.42, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-octyl-1,3-benzothiazol-2-one is sourced from PubChem (CID 3766804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).