About propan-2-yl phenazine-2-carboxylate
propan-2-yl phenazine-2-carboxylate (PubChem CID 3767092) has the molecular formula C16H14N2O2
and a molecular weight of 266.30 g/mol. Its IUPAC name is propan-2-yl phenazine-2-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl phenazine-2-carboxylate |
| PubChem CID | 3767092 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | propan-2-yl phenazine-2-carboxylate |
| SMILES | CC(C)OC(=O)c1ccc2nc3ccccc3nc2c1 |
| InChI | InChI=1S/C16H14N2O2/c1-10(2)20-16(19)11-7-8-14-15(9-11)18-13-6-4-3-5-12(13)17-14/h3-10H,1-2H3 |
| InChIKey | XVOYQUOLLGCTBL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl phenazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl phenazine-2-carboxylate?
The IUPAC name of propan-2-yl phenazine-2-carboxylate (CID 3767092) is propan-2-yl phenazine-2-carboxylate.
What is the SMILES notation for propan-2-yl phenazine-2-carboxylate?
The canonical SMILES for propan-2-yl phenazine-2-carboxylate is CC(C)OC(=O)c1ccc2nc3ccccc3nc2c1.
What is the InChIKey of propan-2-yl phenazine-2-carboxylate?
The InChIKey is XVOYQUOLLGCTBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O2/c1-10(2)20-16(19)11-7-8-14-15(9-11)18-13-6-4-3-5-12(13)17-14/h3-10H,1-2H3.
What are the key properties of propan-2-yl phenazine-2-carboxylate?
propan-2-yl phenazine-2-carboxylate has a molecular weight of 266.30 g/mol, XLogP of 3.35, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl phenazine-2-carboxylate is sourced from PubChem (CID 3767092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).