C12H12F3NO5S — CID 3767269
2-[2-oxo-2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]sulfonylacetic acid (PubChem CID 3767269) has the molecular formula C12H12F3NO5S and a molecular weight of 339.29 g/mol. Its IUPAC name is 2-[2-oxo-2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]sulfonylacetic acid.
| Compound Name | 2-[2-oxo-2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]sulfonylacetic acid |
|---|---|
| PubChem CID | 3767269 |
| Molecular Formula | C12H12F3NO5S |
| Molecular Weight | 339.29 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 2-[2-oxo-2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]sulfonylacetic acid |
| SMILES | O=C(O)CS(=O)(=O)CC(=O)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H12F3NO5S/c13-12(14,15)9-3-1-2-8(4-9)5-16-10(17)6-22(20,21)7-11(18)19/h1-4H,5-7H2,(H,16,17)(H,18,19) |
| InChIKey | QWHWWKNDZRCFEU-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |