C18H18N10 — CID 3767723
3,5-bis[1-(benzotriazol-1-yl)ethyl]-1,2,4-triazol-4-amine (PubChem CID 3767723) has the molecular formula C18H18N10 and a molecular weight of 374.41 g/mol. Its IUPAC name is 3,5-bis[1-(benzotriazol-1-yl)ethyl]-1,2,4-triazol-4-amine.
| Compound Name | 3,5-bis[1-(benzotriazol-1-yl)ethyl]-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 3767723 |
| Molecular Formula | C18H18N10 |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 3,5-bis[1-(benzotriazol-1-yl)ethyl]-1,2,4-triazol-4-amine |
| SMILES | CC(c1nnc(C(C)n2nnc3ccccc32)n1N)n1nnc2ccccc21 |
| InChI | InChI=1S/C18H18N10/c1-11(27-15-9-5-3-7-13(15)20-24-27)17-22-23-18(26(17)19)12(2)28-16-10-6-4-8-14(16)21-25-28/h3-12H,19H2,1-2H3 |
| InChIKey | CFHUQDJBCYMMRJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 118.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |