C28H32O5 — CID 3768048
8a-hydroxy-2-(4-methoxyphenyl)-5'-[(4-methoxyphenyl)methylidene]spiro[4,4a,5,6,7,8-hexahydro-2H-chromene-3,2'-cyclopentane]-1'-one (PubChem CID 3768048) has the molecular formula C28H32O5 and a molecular weight of 448.56 g/mol. Its IUPAC name is 8a-hydroxy-2-(4-methoxyphenyl)-5'-[(4-methoxyphenyl)methylidene]spiro[4,4a,5,6,7,8-hexahydro-2H-chromene-3,2'-cyclopentane]-1'-one.
| Compound Name | 8a-hydroxy-2-(4-methoxyphenyl)-5'-[(4-methoxyphenyl)methylidene]spiro[4,4a,5,6,7,8-hexahydro-2H-chromene-3,2'-cyclopentane]-1'-one |
|---|---|
| PubChem CID | 3768048 |
| Molecular Formula | C28H32O5 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 8a-hydroxy-2-(4-methoxyphenyl)-5'-[(4-methoxyphenyl)methylidene]spiro[4,4a,5,6,7,8-hexahydro-2H-chromene-3,2'-cyclopentane]-1'-one |
| SMILES | COc1ccc(C=C2CCC3(CC4CCCCC4(O)OC3c3ccc(OC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C28H32O5/c1-31-23-10-6-19(7-11-23)17-21-14-16-27(25(21)29)18-22-5-3-4-15-28(22,30)33-26(27)20-8-12-24(32-2)13-9-20/h6-13,17,22,26,30H,3-5,14-16,18H2,1-2H3 |
| InChIKey | LHZZMHLXKOFUGQ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|