C33H49NO8 — CID 3768167
3',6',10,11b-tetramethyl-3-[4,5,6-trihydroxy-3-(hydroxymethyl)oxan-2-yl]oxyspiro[1,2,3,4,6,6a,6b,7,8,11a-decahydrobenzo[a]fluorene-9,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-11-one (PubChem CID 3768167) has the molecular formula C33H49NO8 and a molecular weight of 587.75 g/mol. Its IUPAC name is 3',6',10,11b-tetramethyl-3-[4,5,6-trihydroxy-3-(hydroxymethyl)oxan-2-yl]oxyspiro[1,2,3,4,6,6a,6b,7,8,11a-decahydrobenzo[a]fluorene-9,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-11-one.
| Compound Name | 3',6',10,11b-tetramethyl-3-[4,5,6-trihydroxy-3-(hydroxymethyl)oxan-2-yl]oxyspiro[1,2,3,4,6,6a,6b,7,8,11a-decahydrobenzo[a]fluorene-9,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-11-one |
|---|---|
| PubChem CID | 3768167 |
| Molecular Formula | C33H49NO8 |
| Molecular Weight | 587.75 g/mol |
| Exact Mass | 587.35 |
| IUPAC Name | 3',6',10,11b-tetramethyl-3-[4,5,6-trihydroxy-3-(hydroxymethyl)oxan-2-yl]oxyspiro[1,2,3,4,6,6a,6b,7,8,11a-decahydrobenzo[a]fluorene-9,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-11-one |
| SMILES | CC1=C2C(=O)C3C(CC=C4CC(OC5OC(O)C(O)C(O)C5CO)CCC43C)C2CCC12OC1CC(C)CNC1C2C |
| InChI | InChI=1S/C33H49NO8/c1-15-11-23-26(34-13-15)17(3)33(42-23)10-8-20-21-6-5-18-12-19(40-31-22(14-35)27(36)29(38)30(39)41-31)7-9-32(18,4)25(21)28(37)24(20)16(33)2/h5,15,17,19-23,25-27,29-31,34-36,38-39H,6-14H2,1-4H3 |
| InChIKey | WOWOEXHOMMENAS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 137.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.75 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|