C22H17Cl3F3N7O4 — CID 3768364
5-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-3-[1-(2,4-dichlorophenyl)-3-methyl-5-oxo-1,2,4-triazolidin-3-yl]-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 3768364) has the molecular formula C22H17Cl3F3N7O4 and a molecular weight of 606.78 g/mol. Its IUPAC name is 5-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-3-[1-(2,4-dichlorophenyl)-3-methyl-5-oxo-1,2,4-triazolidin-3-yl]-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | 5-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-3-[1-(2,4-dichlorophenyl)-3-methyl-5-oxo-1,2,4-triazolidin-3-yl]-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 3768364 |
| Molecular Formula | C22H17Cl3F3N7O4 |
| Molecular Weight | 606.78 g/mol |
| Exact Mass | 605.04 |
| IUPAC Name | 5-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-3-[1-(2,4-dichlorophenyl)-3-methyl-5-oxo-1,2,4-triazolidin-3-yl]-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | CC1(C2=NOC3C(=O)N(CCNc4ncc(C(F)(F)F)cc4Cl)C(=O)C23)NC(=O)N(c2ccc(Cl)cc2Cl)N1 |
| InChI | InChI=1S/C22H17Cl3F3N7O4/c1-21(31-20(38)35(33-21)13-3-2-10(23)7-11(13)24)16-14-15(39-32-16)19(37)34(18(14)36)5-4-29-17-12(25)6-9(8-30-17)22(26,27)28/h2-3,6-8,14-15,33H,4-5H2,1H3,(H,29,30)(H,31,38) |
| InChIKey | PBCOIJSATMQQKO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 128.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.78 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|