C17H14N4O2 — CID 3768655
3-imino-1,5-dimethyl-7-phenyl-2,6-dioxabicyclo[2.2.2]octane-4,8,8-tricarbonitrile (PubChem CID 3768655) has the molecular formula C17H14N4O2 and a molecular weight of 306.32 g/mol. Its IUPAC name is 3-imino-1,5-dimethyl-7-phenyl-2,6-dioxabicyclo[2.2.2]octane-4,8,8-tricarbonitrile.
| Compound Name | 3-imino-1,5-dimethyl-7-phenyl-2,6-dioxabicyclo[2.2.2]octane-4,8,8-tricarbonitrile |
|---|---|
| PubChem CID | 3768655 |
| Molecular Formula | C17H14N4O2 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 3-imino-1,5-dimethyl-7-phenyl-2,6-dioxabicyclo[2.2.2]octane-4,8,8-tricarbonitrile |
| SMILES | [H]/N=C1\OC2(C)OC(C)C1(C#N)C(C#N)(C#N)C2c1ccccc1 |
| InChI | InChI=1S/C17H14N4O2/c1-11-17(10-20)14(21)23-15(2,22-11)13(16(17,8-18)9-19)12-6-4-3-5-7-12/h3-7,11,13,21H,1-2H3/b21-14- |
| InChIKey | ZGSIUXJGHMMDAO-STZFKDTASA-N |
| XLogP | 2.46 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|