C19H17ClN2O4 — CID 3768731
1-(3-chlorophenyl)-3-(3,4-dihydroxyphenyl)-5-propylpyrazole-4-carboxylic acid (PubChem CID 3768731) has the molecular formula C19H17ClN2O4 and a molecular weight of 372.81 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(3,4-dihydroxyphenyl)-5-propylpyrazole-4-carboxylic acid.
| Compound Name | 1-(3-chlorophenyl)-3-(3,4-dihydroxyphenyl)-5-propylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 3768731 |
| Molecular Formula | C19H17ClN2O4 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(3,4-dihydroxyphenyl)-5-propylpyrazole-4-carboxylic acid |
| SMILES | CCCc1c(C(=O)O)c(-c2ccc(O)c(O)c2)nn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H17ClN2O4/c1-2-4-14-17(19(25)26)18(11-7-8-15(23)16(24)9-11)21-22(14)13-6-3-5-12(20)10-13/h3,5-10,23-24H,2,4H2,1H3,(H,25,26) |
| InChIKey | OLGBBBXOBOVVGL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|