C24H27ClN4S — CID 3768931
4-[4-(3-chlorophenyl)piperazin-1-yl]-2-phenyl-6-(propan-2-ylsulfanylmethyl)pyrimidine (PubChem CID 3768931) has the molecular formula C24H27ClN4S and a molecular weight of 439.03 g/mol. Its IUPAC name is 4-[4-(3-chlorophenyl)piperazin-1-yl]-2-phenyl-6-(propan-2-ylsulfanylmethyl)pyrimidine.
| Compound Name | 4-[4-(3-chlorophenyl)piperazin-1-yl]-2-phenyl-6-(propan-2-ylsulfanylmethyl)pyrimidine |
|---|---|
| PubChem CID | 3768931 |
| Molecular Formula | C24H27ClN4S |
| Molecular Weight | 439.03 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 4-[4-(3-chlorophenyl)piperazin-1-yl]-2-phenyl-6-(propan-2-ylsulfanylmethyl)pyrimidine |
| SMILES | CC(C)SCc1cc(N2CCN(c3cccc(Cl)c3)CC2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C24H27ClN4S/c1-18(2)30-17-21-16-23(27-24(26-21)19-7-4-3-5-8-19)29-13-11-28(12-14-29)22-10-6-9-20(25)15-22/h3-10,15-16,18H,11-14,17H2,1-2H3 |
| InChIKey | TTYAPODURNKYRV-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.03 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |